About 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol
5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol (PubChem CID 142871973) has the molecular formula C15H22N2OS
and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol.
Molecular Properties
| Compound Name | 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol |
| PubChem CID | 142871973 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol |
| SMILES | CCCC(C)c1ccc(S)cc1.Cc1cc(N)no1 |
| InChI | InChI=1S/C11H16S.C4H6N2O/c1-3-4-9(2)10-5-7-11(12)8-6-10;1-3-2-4(5)6-7-3/h5-9,12H,3-4H2,1-2H3;2H,1H3,(H2,5,6) |
| InChIKey | CAUVYMNEPKKWOM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol?
The IUPAC name of 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol (CID 142871973) is 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol.
What is the SMILES notation for 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol?
The canonical SMILES for 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol is CCCC(C)c1ccc(S)cc1.Cc1cc(N)no1.
What is the InChIKey of 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol?
The InChIKey is CAUVYMNEPKKWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16S.C4H6N2O/c1-3-4-9(2)10-5-7-11(12)8-6-10;1-3-2-4(5)6-7-3/h5-9,12H,3-4H2,1-2H3;2H,1H3,(H2,5,6).
What are the key properties of 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol?
5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol has a molecular weight of 278.42 g/mol, XLogP of 4.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2-oxazol-3-amine;4-pentan-2-ylbenzenethiol is sourced from PubChem (CID 142871973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).