C20H31O4+ — CID 142872726
[2,3-dimethoxy-6-methyl-4-oxo-5-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-dien-1-ylidene]oxidanium (PubChem CID 142872726) has the molecular formula C20H31O4+ and a molecular weight of 335.46 g/mol. Its IUPAC name is [2,3-dimethoxy-6-methyl-4-oxo-5-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-dien-1-ylidene]oxidanium.
| Compound Name | [2,3-dimethoxy-6-methyl-4-oxo-5-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-dien-1-ylidene]oxidanium |
|---|---|
| PubChem CID | 142872726 |
| Molecular Formula | C20H31O4+ |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | [2,3-dimethoxy-6-methyl-4-oxo-5-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-dien-1-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\C(C)=C(C(C)(C)C/C=C(\C)CC(C)C)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C20H30O4/c1-12(2)11-13(3)9-10-20(5,6)15-14(4)16(21)18(23-7)19(24-8)17(15)22/h9,12H,10-11H2,1-8H3/p+1/b13-9+ |
| InChIKey | ZOKFHEFFIBCJKR-UKTHLTGXSA-O |
| XLogP | 4.34 |
| TPSA | 56.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|