About [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid
[3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid (PubChem CID 142872882) has the molecular formula C9H11ClF3NO2S2
and a molecular weight of 321.77 g/mol. Its IUPAC name is [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid.
Molecular Properties
| Compound Name | [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid |
| PubChem CID | 142872882 |
| Molecular Formula | C9H11ClF3NO2S2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid |
| SMILES | O=C(S)SC(CC(Cl)C(F)(F)F)N1CCCC1=O |
| InChI | InChI=1S/C9H11ClF3NO2S2/c10-5(9(11,12)13)4-7(18-8(16)17)14-3-1-2-6(14)15/h5,7H,1-4H2,(H,16,17) |
| InChIKey | DWLXNTHEZFKPDH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid?
The IUPAC name of [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid (CID 142872882) is [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid.
What is the SMILES notation for [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid?
The canonical SMILES for [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid is O=C(S)SC(CC(Cl)C(F)(F)F)N1CCCC1=O.
What is the InChIKey of [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid?
The InChIKey is DWLXNTHEZFKPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClF3NO2S2/c10-5(9(11,12)13)4-7(18-8(16)17)14-3-1-2-6(14)15/h5,7H,1-4H2,(H,16,17).
What are the key properties of [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid?
[3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid has a molecular weight of 321.77 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4,4,4-trifluoro-1-(2-oxopyrrolidin-1-yl)butyl]sulfanylmethanethioic S-acid is sourced from PubChem (CID 142872882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).