C13H14N2O — CID 142873431
2-methyl-1,3,4,5-tetrahydrobenzo[c][1,6]naphthyridin-6-one (PubChem CID 142873431) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-methyl-1,3,4,5-tetrahydrobenzo[c][1,6]naphthyridin-6-one.
| Compound Name | 2-methyl-1,3,4,5-tetrahydrobenzo[c][1,6]naphthyridin-6-one |
|---|---|
| PubChem CID | 142873431 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-methyl-1,3,4,5-tetrahydrobenzo[c][1,6]naphthyridin-6-one |
| SMILES | CN1CCc2[nH]c(=O)c3ccccc3c2C1 |
| InChI | InChI=1S/C13H14N2O/c1-15-7-6-12-11(8-15)9-4-2-3-5-10(9)13(16)14-12/h2-5H,6-8H2,1H3,(H,14,16) |
| InChIKey | MCIXYGKETDESGL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |