C22H32O3 — CID 14287363
[(2S,3R,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl] acetate (PubChem CID 14287363) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(2S,3R,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl] acetate.
| Compound Name | [(2S,3R,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 14287363 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(2S,3R,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-10-oxo-1,3,4,5,6,7,8a,9-octahydrophenanthren-3-yl] acetate |
| SMILES | C=C[C@]1(C)CC2=C(C[C@H]1OC(C)=O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2=O |
| InChI | InChI=1S/C22H32O3/c1-7-21(5)13-15-16(11-19(21)25-14(2)23)22(6)10-8-9-20(3,4)18(22)12-17(15)24/h7,18-19H,1,8-13H2,2-6H3/t18-,19+,21+,22+/m0/s1 |
| InChIKey | QSGPAMWFRMOPST-YVNJGZBMSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|