C22H30O4 — CID 14287365
[(2S,3S,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-4,10-dioxo-3,5,6,7,8a,9-hexahydro-1H-phenanthren-3-yl] acetate (PubChem CID 14287365) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(2S,3S,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-4,10-dioxo-3,5,6,7,8a,9-hexahydro-1H-phenanthren-3-yl] acetate.
| Compound Name | [(2S,3S,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-4,10-dioxo-3,5,6,7,8a,9-hexahydro-1H-phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 14287365 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(2S,3S,4bS,8aS)-2-ethenyl-2,4b,8,8-tetramethyl-4,10-dioxo-3,5,6,7,8a,9-hexahydro-1H-phenanthren-3-yl] acetate |
| SMILES | C=C[C@]1(C)CC2=C(C(=O)[C@H]1OC(C)=O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2=O |
| InChI | InChI=1S/C22H30O4/c1-7-21(5)12-14-15(24)11-16-20(3,4)9-8-10-22(16,6)17(14)18(25)19(21)26-13(2)23/h7,16,19H,1,8-12H2,2-6H3/t16-,19+,21+,22-/m0/s1 |
| InChIKey | XAYVLUVWBBOCRT-MQYXYMALSA-N |
| XLogP | 4.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|