About 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine
6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine (PubChem CID 142873687) has the molecular formula C25H34N4O
and a molecular weight of 406.57 g/mol. Its IUPAC name is 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine.
Molecular Properties
| Compound Name | 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine |
| PubChem CID | 142873687 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine |
| SMILES | C=C(C)CCN/C=C\C.CCCCn1c(=O)[nH]c2cc(Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H19N3O.C8H15N/c1-2-3-11-20-16-10-9-14(12-15(16)19-17(20)21)18-13-7-5-4-6-8-13;1-4-6-9-7-5-8(2)3/h4-10,12,18H,2-3,11H2,1H3,(H,19,21);4,6,9H,2,5,7H2,1,3H3/b;6-4- |
| InChIKey | YUZNREMQTVUABS-QQLTZMNSSA-N |
| XLogP | 5.95 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine?
The IUPAC name of 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine (CID 142873687) is 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine.
What is the SMILES notation for 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine?
The canonical SMILES for 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine is C=C(C)CCN/C=C\C.CCCCn1c(=O)[nH]c2cc(Nc3ccccc3)ccc21.
What is the InChIKey of 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine?
The InChIKey is YUZNREMQTVUABS-QQLTZMNSSA-N. The full InChI is InChI=1S/C17H19N3O.C8H15N/c1-2-3-11-20-16-10-9-14(12-15(16)19-17(20)21)18-13-7-5-4-6-8-13;1-4-6-9-7-5-8(2)3/h4-10,12,18H,2-3,11H2,1H3,(H,19,21);4,6,9H,2,5,7H2,1,3H3/b;6-4-.
What are the key properties of 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine?
6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine has a molecular weight of 406.57 g/mol, XLogP of 5.95, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine is sourced from PubChem (CID 142873687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).