C25H34N4O — CID 142873687
6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine (PubChem CID 142873687) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine.
| Compound Name | 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 142873687 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 6-anilino-3-butyl-1H-benzimidazol-2-one;3-methyl-N-[(Z)-prop-1-enyl]but-3-en-1-amine |
| SMILES | C=C(C)CCN/C=C\C.CCCCn1c(=O)[nH]c2cc(Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H19N3O.C8H15N/c1-2-3-11-20-16-10-9-14(12-15(16)19-17(20)21)18-13-7-5-4-6-8-13;1-4-6-9-7-5-8(2)3/h4-10,12,18H,2-3,11H2,1H3,(H,19,21);4,6,9H,2,5,7H2,1,3H3/b;6-4- |
| InChIKey | YUZNREMQTVUABS-QQLTZMNSSA-N |
| XLogP | 5.95 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|