C12H15NO — CID 142874445
3-[(3E)-hexa-1,3,5-trien-3-yl]-5-propyl-1,2-oxazole (PubChem CID 142874445) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-5-propyl-1,2-oxazole.
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-5-propyl-1,2-oxazole |
|---|---|
| PubChem CID | 142874445 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-5-propyl-1,2-oxazole |
| SMILES | C=C/C=C(\C=C)c1cc(CCC)on1 |
| InChI | InChI=1S/C12H15NO/c1-4-7-10(6-3)12-9-11(8-5-2)14-13-12/h4,6-7,9H,1,3,5,8H2,2H3/b10-7+ |
| InChIKey | UTJYQBHVARQJOE-JXMROGBWSA-N |
| XLogP | 3.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|