C15H25NO — CID 142874614
ethane;N-[2-(1,2,3,4,7,8-hexahydronaphthalen-1-yl)ethyl]formamide (PubChem CID 142874614) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;N-[2-(1,2,3,4,7,8-hexahydronaphthalen-1-yl)ethyl]formamide.
| Compound Name | ethane;N-[2-(1,2,3,4,7,8-hexahydronaphthalen-1-yl)ethyl]formamide |
|---|---|
| PubChem CID | 142874614 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;N-[2-(1,2,3,4,7,8-hexahydronaphthalen-1-yl)ethyl]formamide |
| SMILES | CC.O=CNCCC1CCCC2=C1CCC=C2 |
| InChI | InChI=1S/C13H19NO.C2H6/c15-10-14-9-8-12-6-3-5-11-4-1-2-7-13(11)12;1-2/h1,4,10,12H,2-3,5-9H2,(H,14,15);1-2H3 |
| InChIKey | ZRLOZTITOBRKNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|