C15H22N4O — CID 142874925
6-(cyclohexylmethyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 142874925) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-(cyclohexylmethyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-(cyclohexylmethyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142874925 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 6-(cyclohexylmethyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCn1ncc2c(=O)[nH]c(CC3CCCCC3)nc21 |
| InChI | InChI=1S/C15H22N4O/c1-2-8-19-14-12(10-16-19)15(20)18-13(17-14)9-11-6-4-3-5-7-11/h10-11H,2-9H2,1H3,(H,17,18,20) |
| InChIKey | MEZNKDSXFUJARI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |