C24H35FN4O3 — CID 142875249
N-(5-fluoro-3,4-dihydropyridin-2-yl)formamide;2-[(phenylmethoxyamino)methyl]-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 142875249) has the molecular formula C24H35FN4O3 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-(5-fluoro-3,4-dihydropyridin-2-yl)formamide;2-[(phenylmethoxyamino)methyl]-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | N-(5-fluoro-3,4-dihydropyridin-2-yl)formamide;2-[(phenylmethoxyamino)methyl]-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 142875249 |
| Molecular Formula | C24H35FN4O3 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-(5-fluoro-3,4-dihydropyridin-2-yl)formamide;2-[(phenylmethoxyamino)methyl]-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | CCCCC(CNOCc1ccccc1)C(=O)N1CCCC1.O=CNC1=NC=C(F)CC1 |
| InChI | InChI=1S/C18H28N2O2.C6H7FN2O/c1-2-3-11-17(18(21)20-12-7-8-13-20)14-19-22-15-16-9-5-4-6-10-16;7-5-1-2-6(8-3-5)9-4-10/h4-6,9-10,17,19H,2-3,7-8,11-15H2,1H3;3-4H,1-2H2,(H,8,9,10) |
| InChIKey | DVEYFEOZQWFVJR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|