C12H23NO — CID 142875287
5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-oxazine;ethane (PubChem CID 142875287) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-oxazine;ethane.
| Compound Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-oxazine;ethane |
|---|---|
| PubChem CID | 142875287 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-oxazine;ethane |
| SMILES | C=CC1=C(C=C)OCCN1.CC.CC |
| InChI | InChI=1S/C8H11NO.2C2H6/c1-3-7-8(4-2)10-6-5-9-7;2*1-2/h3-4,9H,1-2,5-6H2;2*1-2H3 |
| InChIKey | NXPBKQZAJICANH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |