C9H16N4 — CID 142875433
N-[3-[(Z)-but-1-enyl]-1,2,4-triazol-4-yl]methanimine;ethane (PubChem CID 142875433) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[3-[(Z)-but-1-enyl]-1,2,4-triazol-4-yl]methanimine;ethane.
| Compound Name | N-[3-[(Z)-but-1-enyl]-1,2,4-triazol-4-yl]methanimine;ethane |
|---|---|
| PubChem CID | 142875433 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-[3-[(Z)-but-1-enyl]-1,2,4-triazol-4-yl]methanimine;ethane |
| SMILES | C=Nn1cnnc1/C=C\CC.CC |
| InChI | InChI=1S/C7H10N4.C2H6/c1-3-4-5-7-10-9-6-11(7)8-2;1-2/h4-6H,2-3H2,1H3;1-2H3/b5-4-; |
| InChIKey | GNURFXSRPDIEAQ-MKWAYWHRSA-N |
| XLogP | 2.19 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|