C27H43N4O2+ — CID 142875568
1-butyl-3-(cycloheptylmethyl)-9-[(1-methylpyridin-1-ium-3-yl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 142875568) has the molecular formula C27H43N4O2+ and a molecular weight of 455.67 g/mol. Its IUPAC name is 1-butyl-3-(cycloheptylmethyl)-9-[(1-methylpyridin-1-ium-3-yl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 1-butyl-3-(cycloheptylmethyl)-9-[(1-methylpyridin-1-ium-3-yl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 142875568 |
| Molecular Formula | C27H43N4O2+ |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | 1-butyl-3-(cycloheptylmethyl)-9-[(1-methylpyridin-1-ium-3-yl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)C(CC2CCCCCC2)NC(=O)C12CCN(Cc1ccc[n+](C)c1)CC2 |
| InChI | InChI=1S/C27H42N4O2/c1-3-4-16-31-25(32)24(19-22-10-7-5-6-8-11-22)28-26(33)27(31)13-17-30(18-14-27)21-23-12-9-15-29(2)20-23/h9,12,15,20,22,24H,3-8,10-11,13-14,16-19,21H2,1-2H3/p+1 |
| InChIKey | PYUYBHJRYUEMAA-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 56.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|