About S-chloro 4-methylpiperidine-1-carbothioate
S-chloro 4-methylpiperidine-1-carbothioate (PubChem CID 142875876) has the molecular formula C7H12ClNOS
and a molecular weight of 193.70 g/mol. Its IUPAC name is S-chloro 4-methylpiperidine-1-carbothioate.
Molecular Properties
| Compound Name | S-chloro 4-methylpiperidine-1-carbothioate |
| PubChem CID | 142875876 |
| Molecular Formula | C7H12ClNOS |
| Molecular Weight | 193.70 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | S-chloro 4-methylpiperidine-1-carbothioate |
| SMILES | CC1CCN(C(=O)SCl)CC1 |
| InChI | InChI=1S/C7H12ClNOS/c1-6-2-4-9(5-3-6)7(10)11-8/h6H,2-5H2,1H3 |
| InChIKey | NBPIMWLNZBXUSG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-chloro 4-methylpiperidine-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-chloro 4-methylpiperidine-1-carbothioate?
The IUPAC name of S-chloro 4-methylpiperidine-1-carbothioate (CID 142875876) is S-chloro 4-methylpiperidine-1-carbothioate.
What is the SMILES notation for S-chloro 4-methylpiperidine-1-carbothioate?
The canonical SMILES for S-chloro 4-methylpiperidine-1-carbothioate is CC1CCN(C(=O)SCl)CC1.
What is the InChIKey of S-chloro 4-methylpiperidine-1-carbothioate?
The InChIKey is NBPIMWLNZBXUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNOS/c1-6-2-4-9(5-3-6)7(10)11-8/h6H,2-5H2,1H3.
What are the key properties of S-chloro 4-methylpiperidine-1-carbothioate?
S-chloro 4-methylpiperidine-1-carbothioate has a molecular weight of 193.70 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-chloro 4-methylpiperidine-1-carbothioate is sourced from PubChem (CID 142875876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).