C11H19NO — CID 142876075
ethane;4-methoxy-N,3-dimethylaniline (PubChem CID 142876075) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;4-methoxy-N,3-dimethylaniline.
| Compound Name | ethane;4-methoxy-N,3-dimethylaniline |
|---|---|
| PubChem CID | 142876075 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;4-methoxy-N,3-dimethylaniline |
| SMILES | CC.CNc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C9H13NO.C2H6/c1-7-6-8(10-2)4-5-9(7)11-3;1-2/h4-6,10H,1-3H3;1-2H3 |
| InChIKey | FGGLTQCERYRFOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|