C18H25N7O — CID 142876140
4-[[4-(cyclopropylamino)-6-(piperidin-4-ylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenol (PubChem CID 142876140) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is 4-[[4-(cyclopropylamino)-6-(piperidin-4-ylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenol.
| Compound Name | 4-[[4-(cyclopropylamino)-6-(piperidin-4-ylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 142876140 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 4-[[4-(cyclopropylamino)-6-(piperidin-4-ylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenol |
| SMILES | Cc1cc(Nc2nc(NC3CCNCC3)nc(NC3CC3)n2)ccc1O |
| InChI | InChI=1S/C18H25N7O/c1-11-10-14(4-5-15(11)26)22-18-24-16(20-12-2-3-12)23-17(25-18)21-13-6-8-19-9-7-13/h4-5,10,12-13,19,26H,2-3,6-9H2,1H3,(H3,20,21,22,23,24,25) |
| InChIKey | CCKAUIQZWQXIHP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|