C16H27N3 — CID 142876584
N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine;propane (PubChem CID 142876584) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine;propane.
| Compound Name | N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine;propane |
|---|---|
| PubChem CID | 142876584 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine;propane |
| SMILES | C=C/C=C(\Nc1ccn[nH]1)C1CCCCC1.CCC |
| InChI | InChI=1S/C13H19N3.C3H8/c1-2-6-12(11-7-4-3-5-8-11)15-13-9-10-14-16-13;1-3-2/h2,6,9-11H,1,3-5,7-8H2,(H2,14,15,16);3H2,1-2H3/b12-6-; |
| InChIKey | OBVHMMSGHCGSDS-DAMYXMBDSA-N |
| XLogP | 4.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|