About 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane
3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane (PubChem CID 142876809) has the molecular formula C21H35N3
and a molecular weight of 329.53 g/mol. Its IUPAC name is 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane.
Molecular Properties
| Compound Name | 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane |
| PubChem CID | 142876809 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane |
| SMILES | C=C(c1cc(C#N)ccc1NC)C1CCCC1.CCC.CN(C)C |
| InChI | InChI=1S/C15H18N2.C3H9N.C3H8/c1-11(13-5-3-4-6-13)14-9-12(10-16)7-8-15(14)17-2;1-4(2)3;1-3-2/h7-9,13,17H,1,3-6H2,2H3;1-3H3;3H2,1-2H3 |
| InChIKey | BUHGHNFBAPZOFQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane?
The IUPAC name of 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane (CID 142876809) is 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane.
What is the SMILES notation for 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane?
The canonical SMILES for 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane is C=C(c1cc(C#N)ccc1NC)C1CCCC1.CCC.CN(C)C.
What is the InChIKey of 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane?
The InChIKey is BUHGHNFBAPZOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.C3H9N.C3H8/c1-11(13-5-3-4-6-13)14-9-12(10-16)7-8-15(14)17-2;1-4(2)3;1-3-2/h7-9,13,17H,1,3-6H2,2H3;1-3H3;3H2,1-2H3.
What are the key properties of 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane?
3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane has a molecular weight of 329.53 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-cyclopentylethenyl)-4-(methylamino)benzonitrile;N,N-dimethylmethanamine;propane is sourced from PubChem (CID 142876809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).