About ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine
ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine (PubChem CID 142876939) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine |
| PubChem CID | 142876939 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine |
| SMILES | CC.CC.Cc1oc2cccnc2c1C(C)C |
| InChI | InChI=1S/C11H13NO.2C2H6/c1-7(2)10-8(3)13-9-5-4-6-12-11(9)10;2*1-2/h4-7H,1-3H3;2*1-2H3 |
| InChIKey | FUALYQBRXNEOGH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine?
The IUPAC name of ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine (CID 142876939) is ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine.
What is the SMILES notation for ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine?
The canonical SMILES for ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine is CC.CC.Cc1oc2cccnc2c1C(C)C.
What is the InChIKey of ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine?
The InChIKey is FUALYQBRXNEOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO.2C2H6/c1-7(2)10-8(3)13-9-5-4-6-12-11(9)10;2*1-2/h4-7H,1-3H3;2*1-2H3.
What are the key properties of ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine?
ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine has a molecular weight of 235.37 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-propan-2-ylfuro[3,2-b]pyridine is sourced from PubChem (CID 142876939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).