C15H25NO2 — CID 142877351
ethane;3-methyl-2-(methylamino)-3-(3-methylphenyl)butanoic acid (PubChem CID 142877351) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;3-methyl-2-(methylamino)-3-(3-methylphenyl)butanoic acid.
| Compound Name | ethane;3-methyl-2-(methylamino)-3-(3-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 142877351 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;3-methyl-2-(methylamino)-3-(3-methylphenyl)butanoic acid |
| SMILES | CC.CNC(C(=O)O)C(C)(C)c1cccc(C)c1 |
| InChI | InChI=1S/C13H19NO2.C2H6/c1-9-6-5-7-10(8-9)13(2,3)11(14-4)12(15)16;1-2/h5-8,11,14H,1-4H3,(H,15,16);1-2H3 |
| InChIKey | YOFOVALIPLWTGL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |