C31H45F6N3O4 — CID 142877353
ethyl (E,4S)-4-[[(2S)-2-[[(2R)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)-2-methylpropanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 142877353) has the molecular formula C31H45F6N3O4 and a molecular weight of 637.71 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(2R)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)-2-methylpropanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(2R)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)-2-methylpropanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 142877353 |
| Molecular Formula | C31H45F6N3O4 |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(2R)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)-2-methylpropanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@@](C)(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H45F6N3O4/c1-12-44-26(42)19(4)13-23(18(2)3)40(11)25(41)24(28(5,6)7)38-27(43)29(8,39(9)10)17-20-14-21(30(32,33)34)16-22(15-20)31(35,36)37/h13-16,18,23-24H,12,17H2,1-11H3,(H,38,43)/b19-13+/t23-,24-,29-/m1/s1 |
| InChIKey | GRNFXOUWGZWIBR-HATKOWQQSA-N |
| XLogP | 6.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|