C23H26N8O4 — CID 142877528
N-(2-aminoethyl)-5-[[5-[[2-(diaminomethylideneamino)acetyl]amino]-1-benzofuran-2-carbonyl]amino]-4,5-dihydro-1H-indole-2-carboxamide (PubChem CID 142877528) has the molecular formula C23H26N8O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-[[5-[[2-(diaminomethylideneamino)acetyl]amino]-1-benzofuran-2-carbonyl]amino]-4,5-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-[[5-[[2-(diaminomethylideneamino)acetyl]amino]-1-benzofuran-2-carbonyl]amino]-4,5-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142877528 |
| Molecular Formula | C23H26N8O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-(2-aminoethyl)-5-[[5-[[2-(diaminomethylideneamino)acetyl]amino]-1-benzofuran-2-carbonyl]amino]-4,5-dihydro-1H-indole-2-carboxamide |
| SMILES | NCCNC(=O)c1cc2c([nH]1)C=CC(NC(=O)c1cc3cc(NC(=O)CN=C(N)N)ccc3o1)C2 |
| InChI | InChI=1S/C23H26N8O4/c24-5-6-27-21(33)17-9-12-7-15(1-3-16(12)31-17)30-22(34)19-10-13-8-14(2-4-18(13)35-19)29-20(32)11-28-23(25)26/h1-4,8-10,15,31H,5-7,11,24H2,(H,27,33)(H,29,32)(H,30,34)(H4,25,26,28) |
| InChIKey | AORMLUQEHVSILF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 206.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|