C20H32N2 — CID 142877910
(Z)-but-2-ene;N-methyl-N-[(E)-[(Z,4E)-4-prop-2-enylideneoct-5-en-3-ylidene]amino]buta-1,3-dien-2-amine (PubChem CID 142877910) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (Z)-but-2-ene;N-methyl-N-[(E)-[(Z,4E)-4-prop-2-enylideneoct-5-en-3-ylidene]amino]buta-1,3-dien-2-amine.
| Compound Name | (Z)-but-2-ene;N-methyl-N-[(E)-[(Z,4E)-4-prop-2-enylideneoct-5-en-3-ylidene]amino]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142877910 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (Z)-but-2-ene;N-methyl-N-[(E)-[(Z,4E)-4-prop-2-enylideneoct-5-en-3-ylidene]amino]buta-1,3-dien-2-amine |
| SMILES | C/C=C\C.C=C/C=C(\C=C/CC)C(/CC)=N/N(C)C(=C)C=C |
| InChI | InChI=1S/C16H24N2.C4H8/c1-7-11-13-15(12-8-2)16(10-4)17-18(6)14(5)9-3;1-3-4-2/h8-9,11-13H,2-3,5,7,10H2,1,4,6H3;3-4H,1-2H3/b13-11-,15-12+,17-16+;4-3- |
| InChIKey | FKEVQGQXNZQSMD-JRIFXVRSSA-N |
| XLogP | 6.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|