C17H19F3N6O3S — CID 142878059
[3-amino-1-(7-but-2-ynyl-1-methyl-6-oxo-2-sulfanylidene-3H-purin-8-yl)piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 142878059) has the molecular formula C17H19F3N6O3S and a molecular weight of 444.44 g/mol. Its IUPAC name is [3-amino-1-(7-but-2-ynyl-1-methyl-6-oxo-2-sulfanylidene-3H-purin-8-yl)piperidin-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-amino-1-(7-but-2-ynyl-1-methyl-6-oxo-2-sulfanylidene-3H-purin-8-yl)piperidin-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142878059 |
| Molecular Formula | C17H19F3N6O3S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [3-amino-1-(7-but-2-ynyl-1-methyl-6-oxo-2-sulfanylidene-3H-purin-8-yl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCC(OC(=O)C(F)(F)F)C(N)C2)nc2[nH]c(=S)n(C)c(=O)c21 |
| InChI | InChI=1S/C17H19F3N6O3S/c1-3-4-6-26-11-12(23-16(30)24(2)13(11)27)22-15(26)25-7-5-10(9(21)8-25)29-14(28)17(18,19)20/h9-10H,5-8,21H2,1-2H3,(H,23,30) |
| InChIKey | RLEOQSAVRNSADO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|