About 2,6-dimethyl-6H-1,3,5-diazaborepine
2,6-dimethyl-6H-1,3,5-diazaborepine (PubChem CID 142878469) has the molecular formula C6H9BN2
and a molecular weight of 119.96 g/mol. Its IUPAC name is 2,6-dimethyl-6H-1,3,5-diazaborepine.
Molecular Properties
| Compound Name | 2,6-dimethyl-6H-1,3,5-diazaborepine |
| PubChem CID | 142878469 |
| Molecular Formula | C6H9BN2 |
| Molecular Weight | 119.96 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 2,6-dimethyl-6H-1,3,5-diazaborepine |
| SMILES | CC1=NC=BC(C)C=N1 |
| InChI | InChI=1S/C6H9BN2/c1-5-3-8-6(2)9-4-7-5/h3-5H,1-2H3 |
| InChIKey | WOFJTLVPCYQLPW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.96 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-6H-1,3,5-diazaborepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-6H-1,3,5-diazaborepine?
The IUPAC name of 2,6-dimethyl-6H-1,3,5-diazaborepine (CID 142878469) is 2,6-dimethyl-6H-1,3,5-diazaborepine.
What is the SMILES notation for 2,6-dimethyl-6H-1,3,5-diazaborepine?
The canonical SMILES for 2,6-dimethyl-6H-1,3,5-diazaborepine is CC1=NC=BC(C)C=N1.
What is the InChIKey of 2,6-dimethyl-6H-1,3,5-diazaborepine?
The InChIKey is WOFJTLVPCYQLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BN2/c1-5-3-8-6(2)9-4-7-5/h3-5H,1-2H3.
What are the key properties of 2,6-dimethyl-6H-1,3,5-diazaborepine?
2,6-dimethyl-6H-1,3,5-diazaborepine has a molecular weight of 119.96 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-6H-1,3,5-diazaborepine is sourced from PubChem (CID 142878469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).