About N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 142878486) has the molecular formula C15H16N2O3S2
and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| PubChem CID | 142878486 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1SC(=S)NC1=O.Cc1ccc(-c2ccc(NO)cc2)o1 |
| InChI | InChI=1S/C11H11NO2.C4H5NOS2/c1-8-2-7-11(14-8)9-3-5-10(12-13)6-4-9;1-2-3(6)5-4(7)8-2/h2-7,12-13H,1H3;2H,1H3,(H,5,6,7) |
| InChIKey | BURUCAZNAUTIMU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one?
The IUPAC name of N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (CID 142878486) is N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one?
The canonical SMILES for N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one is CC1SC(=S)NC1=O.Cc1ccc(-c2ccc(NO)cc2)o1.
What is the InChIKey of N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one?
The InChIKey is BURUCAZNAUTIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.C4H5NOS2/c1-8-2-7-11(14-8)9-3-5-10(12-13)6-4-9;1-2-3(6)5-4(7)8-2/h2-7,12-13H,1H3;2H,1H3,(H,5,6,7).
What are the key properties of N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one?
N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one has a molecular weight of 336.44 g/mol, XLogP of 3.58, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-methylfuran-2-yl)phenyl]hydroxylamine;5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 142878486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).