C25H29FN6O2 — CID 142878695
2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;(3E,5Z)-2-methanimidoylocta-1,3,5-trien-3-amine (PubChem CID 142878695) has the molecular formula C25H29FN6O2 and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;(3E,5Z)-2-methanimidoylocta-1,3,5-trien-3-amine.
| Compound Name | 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;(3E,5Z)-2-methanimidoylocta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142878695 |
| Molecular Formula | C25H29FN6O2 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;(3E,5Z)-2-methanimidoylocta-1,3,5-trien-3-amine |
| SMILES | COc1cc2nc(Nc3ccc(F)cc3)nc(N)c2cc1OC.[H]/N=C/C(=C)/C(N)=C\C=C/CC |
| InChI | InChI=1S/C16H15FN4O2.C9H14N2/c1-22-13-7-11-12(8-14(13)23-2)20-16(21-15(11)18)19-10-5-3-9(17)4-6-10;1-3-4-5-6-9(11)8(2)7-10/h3-8H,1-2H3,(H3,18,19,20,21);4-7,10H,2-3,11H2,1H3/b;5-4-,9-6+,10-7+ |
| InChIKey | JYCIZXDSSMOTBA-YLRCAYMESA-N |
| XLogP | 5.11 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|