About [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine
[2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine (PubChem CID 142878727) has the molecular formula C16H22F4N6O
and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine.
Molecular Properties
| Compound Name | [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine |
| PubChem CID | 142878727 |
| Molecular Formula | C16H22F4N6O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine |
| SMILES | C1CCNCC1.NCc1cc(-n2nnnc2C(F)(F)F)ccc1OCCF |
| InChI | InChI=1S/C11H11F4N5O.C5H11N/c12-3-4-21-9-2-1-8(5-7(9)6-16)20-10(11(13,14)15)17-18-19-20;1-2-4-6-5-3-1/h1-2,5H,3-4,6,16H2;6H,1-5H2 |
| InChIKey | VCRTUIKTTWHFKP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine?
The IUPAC name of [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine (CID 142878727) is [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine.
What is the SMILES notation for [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine?
The canonical SMILES for [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine is C1CCNCC1.NCc1cc(-n2nnnc2C(F)(F)F)ccc1OCCF.
What is the InChIKey of [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine?
The InChIKey is VCRTUIKTTWHFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F4N5O.C5H11N/c12-3-4-21-9-2-1-8(5-7(9)6-16)20-10(11(13,14)15)17-18-19-20;1-2-4-6-5-3-1/h1-2,5H,3-4,6,16H2;6H,1-5H2.
What are the key properties of [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine?
[2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine has a molecular weight of 390.39 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoroethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine;piperidine is sourced from PubChem (CID 142878727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).