About 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane
6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane (PubChem CID 142879421) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane |
| PubChem CID | 142879421 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane |
| SMILES | CC.CC.COc1cc(OC)c2nc(C(=O)O)ccc2n1 |
| InChI | InChI=1S/C11H10N2O4.2C2H6/c1-16-8-5-9(17-2)12-6-3-4-7(11(14)15)13-10(6)8;2*1-2/h3-5H,1-2H3,(H,14,15);2*1-2H3 |
| InChIKey | RLOLFCMVFPLOKD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane?
The IUPAC name of 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane (CID 142879421) is 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane.
What is the SMILES notation for 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane?
The canonical SMILES for 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane is CC.CC.COc1cc(OC)c2nc(C(=O)O)ccc2n1.
What is the InChIKey of 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane?
The InChIKey is RLOLFCMVFPLOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4.2C2H6/c1-16-8-5-9(17-2)12-6-3-4-7(11(14)15)13-10(6)8;2*1-2/h3-5H,1-2H3,(H,14,15);2*1-2H3.
What are the key properties of 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane?
6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane has a molecular weight of 294.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethoxy-1,5-naphthyridine-2-carboxylic acid;ethane is sourced from PubChem (CID 142879421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).