C13H22O6 — CID 142879766
1-[(5S)-6-(2-hydroxypropan-2-yloxy)-2,2,5-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]ethanone (PubChem CID 142879766) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-[(5S)-6-(2-hydroxypropan-2-yloxy)-2,2,5-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]ethanone.
| Compound Name | 1-[(5S)-6-(2-hydroxypropan-2-yloxy)-2,2,5-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]ethanone |
|---|---|
| PubChem CID | 142879766 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[(5S)-6-(2-hydroxypropan-2-yloxy)-2,2,5-trimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]ethanone |
| SMILES | CC(=O)C12O[C@@H](C)C(OC(C)(C)O)C1OC(C)(C)O2 |
| InChI | InChI=1S/C13H22O6/c1-7-9(17-11(3,4)15)10-13(16-7,8(2)14)19-12(5,6)18-10/h7,9-10,15H,1-6H3/t7-,9?,10?,13?/m0/s1 |
| InChIKey | JNPVZYMJPAABQQ-RKSPIEMZSA-N |
| XLogP | 0.96 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|