C16H19N — CID 142880270
(3E)-2-cyclohepta-1,3,6-trien-1-yl-3-ethenyl-N-methylhexa-3,5-dien-1-imine (PubChem CID 142880270) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is (3E)-2-cyclohepta-1,3,6-trien-1-yl-3-ethenyl-N-methylhexa-3,5-dien-1-imine.
| Compound Name | (3E)-2-cyclohepta-1,3,6-trien-1-yl-3-ethenyl-N-methylhexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 142880270 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (3E)-2-cyclohepta-1,3,6-trien-1-yl-3-ethenyl-N-methylhexa-3,5-dien-1-imine |
| SMILES | C=C/C=C(\C=C)C(/C=N/C)C1=CC=CCC=C1 |
| InChI | InChI=1S/C16H19N/c1-4-10-14(5-2)16(13-17-3)15-11-8-6-7-9-12-15/h4-6,8-13,16H,1-2,7H2,3H3/b14-10+,17-13+ |
| InChIKey | LRIRUFSBZOBKBX-JTOAUJHISA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|