About benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane
benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane (PubChem CID 142880292) has the molecular formula C21H35NO2
and a molecular weight of 333.52 g/mol. Its IUPAC name is benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane.
Molecular Properties
| Compound Name | benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane |
| PubChem CID | 142880292 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane |
| SMILES | CC.O=C(CCO)N(CC1CC1)C1CCCCC1.c1ccccc1 |
| InChI | InChI=1S/C13H23NO2.C6H6.C2H6/c15-9-8-13(16)14(10-11-6-7-11)12-4-2-1-3-5-12;1-2-4-6-5-3-1;1-2/h11-12,15H,1-10H2;1-6H;1-2H3 |
| InChIKey | ZAGVCQQVZUTMLK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane?
The IUPAC name of benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane (CID 142880292) is benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane.
What is the SMILES notation for benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane?
The canonical SMILES for benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane is CC.O=C(CCO)N(CC1CC1)C1CCCCC1.c1ccccc1.
What is the InChIKey of benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane?
The InChIKey is ZAGVCQQVZUTMLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2.C6H6.C2H6/c15-9-8-13(16)14(10-11-6-7-11)12-4-2-1-3-5-12;1-2-4-6-5-3-1;1-2/h11-12,15H,1-10H2;1-6H;1-2H3.
What are the key properties of benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane?
benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane has a molecular weight of 333.52 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-cyclohexyl-N-(cyclopropylmethyl)-3-hydroxypropanamide;ethane is sourced from PubChem (CID 142880292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).