C17H24F3NOS — CID 142880378
ethane;(1E,3S,5E)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)nona-1,5,8-trien-3-ol (PubChem CID 142880378) has the molecular formula C17H24F3NOS and a molecular weight of 347.45 g/mol. Its IUPAC name is ethane;(1E,3S,5E)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)nona-1,5,8-trien-3-ol.
| Compound Name | ethane;(1E,3S,5E)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)nona-1,5,8-trien-3-ol |
|---|---|
| PubChem CID | 142880378 |
| Molecular Formula | C17H24F3NOS |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethane;(1E,3S,5E)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)-6-(trifluoromethyl)nona-1,5,8-trien-3-ol |
| SMILES | C=CC/C(=C\C[C@H](O)/C(C)=C/c1csc(C)n1)C(F)(F)F.CC |
| InChI | InChI=1S/C15H18F3NOS.C2H6/c1-4-5-12(15(16,17)18)6-7-14(20)10(2)8-13-9-21-11(3)19-13;1-2/h4,6,8-9,14,20H,1,5,7H2,2-3H3;1-2H3/b10-8+,12-6+;/t14-;/m0./s1 |
| InChIKey | KZBGNGZFGDLTFQ-UQYVIFGOSA-N |
| XLogP | 5.70 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|