About [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate (PubChem CID 14288060) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate |
| PubChem CID | 14288060 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C15H26O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h8,11-14H,6-7,9H2,1-5H3/t12-,13+,14-/m1/s1 |
| InChIKey | KGPJMTFDHBCYTJ-HZSPNIEDSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate?
The IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate (CID 14288060) is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate.
What is the SMILES notation for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate?
The canonical SMILES for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate is CC(C)=CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C.
What is the InChIKey of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate?
The InChIKey is KGPJMTFDHBCYTJ-HZSPNIEDSA-N. The full InChI is InChI=1S/C15H26O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h8,11-14H,6-7,9H2,1-5H3/t12-,13+,14-/m1/s1.
What are the key properties of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate?
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate has a molecular weight of 238.37 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbut-2-enoate is sourced from PubChem (CID 14288060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).