About 3-[(Z)-but-1-enyl]-2,5-dimethylfuran
3-[(Z)-but-1-enyl]-2,5-dimethylfuran (PubChem CID 142881443) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-2,5-dimethylfuran.
Molecular Properties
| Compound Name | 3-[(Z)-but-1-enyl]-2,5-dimethylfuran |
| PubChem CID | 142881443 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-2,5-dimethylfuran |
| SMILES | CC/C=C\c1cc(C)oc1C |
| InChI | InChI=1S/C10H14O/c1-4-5-6-10-7-8(2)11-9(10)3/h5-7H,4H2,1-3H3/b6-5- |
| InChIKey | LQTUWDYTVNUHKZ-WAYWQWQTSA-N |
| XLogP | 3.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(Z)-but-1-enyl]-2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-1-enyl]-2,5-dimethylfuran?
The IUPAC name of 3-[(Z)-but-1-enyl]-2,5-dimethylfuran (CID 142881443) is 3-[(Z)-but-1-enyl]-2,5-dimethylfuran.
What is the SMILES notation for 3-[(Z)-but-1-enyl]-2,5-dimethylfuran?
The canonical SMILES for 3-[(Z)-but-1-enyl]-2,5-dimethylfuran is CC/C=C\c1cc(C)oc1C.
What is the InChIKey of 3-[(Z)-but-1-enyl]-2,5-dimethylfuran?
The InChIKey is LQTUWDYTVNUHKZ-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H14O/c1-4-5-6-10-7-8(2)11-9(10)3/h5-7H,4H2,1-3H3/b6-5-.
What are the key properties of 3-[(Z)-but-1-enyl]-2,5-dimethylfuran?
3-[(Z)-but-1-enyl]-2,5-dimethylfuran has a molecular weight of 150.22 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-1-enyl]-2,5-dimethylfuran is sourced from PubChem (CID 142881443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).