C15H23N3O4 — CID 142881700
2-[[formyl(hydroxy)amino]methyl]-N-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]hexanamide (PubChem CID 142881700) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[formyl(hydroxy)amino]methyl]-N-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]hexanamide.
| Compound Name | 2-[[formyl(hydroxy)amino]methyl]-N-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 142881700 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[[formyl(hydroxy)amino]methyl]-N-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]hexanamide |
| SMILES | CCCCC(CN(O)C=O)C(=O)NCC(=O)c1cccn1C |
| InChI | InChI=1S/C15H23N3O4/c1-3-4-6-12(10-18(22)11-19)15(21)16-9-14(20)13-7-5-8-17(13)2/h5,7-8,11-12,22H,3-4,6,9-10H2,1-2H3,(H,16,21) |
| InChIKey | UCWOIHMCJQPFFR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|