About (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane
(2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane (PubChem CID 142883616) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane.
Molecular Properties
| Compound Name | (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane |
| PubChem CID | 142883616 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane |
| SMILES | CC.CC1C=C(CN)OC1C.CCC |
| InChI | InChI=1S/C7H13NO.C3H8.C2H6/c1-5-3-7(4-8)9-6(5)2;1-3-2;1-2/h3,5-6H,4,8H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | HAHBKKZWCSEEIX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane?
The IUPAC name of (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane (CID 142883616) is (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane.
What is the SMILES notation for (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane?
The canonical SMILES for (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane is CC.CC1C=C(CN)OC1C.CCC.
What is the InChIKey of (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane?
The InChIKey is HAHBKKZWCSEEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H8.C2H6/c1-5-3-7(4-8)9-6(5)2;1-3-2;1-2/h3,5-6H,4,8H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane?
(2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane has a molecular weight of 201.35 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-2,3-dihydrofuran-5-yl)methanamine;ethane;propane is sourced from PubChem (CID 142883616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).