About (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine
(Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine (PubChem CID 142883636) has the molecular formula C10H18BrNO
and a molecular weight of 248.16 g/mol. Its IUPAC name is (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine.
Molecular Properties
| Compound Name | (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine |
| PubChem CID | 142883636 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine |
| SMILES | C=CO/C(=C\CBr)C(N)C(C)(C)C |
| InChI | InChI=1S/C10H18BrNO/c1-5-13-8(6-7-11)9(12)10(2,3)4/h5-6,9H,1,7,12H2,2-4H3/b8-6- |
| InChIKey | NXNYZHOZBYMJJA-VURMDHGXSA-N |
| XLogP | 2.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine?
The IUPAC name of (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine (CID 142883636) is (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine.
What is the SMILES notation for (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine?
The canonical SMILES for (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine is C=CO/C(=C\CBr)C(N)C(C)(C)C.
What is the InChIKey of (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine?
The InChIKey is NXNYZHOZBYMJJA-VURMDHGXSA-N. The full InChI is InChI=1S/C10H18BrNO/c1-5-13-8(6-7-11)9(12)10(2,3)4/h5-6,9H,1,7,12H2,2-4H3/b8-6-.
What are the key properties of (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine?
(Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine has a molecular weight of 248.16 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-bromo-4-ethenoxy-2,2-dimethylhex-4-en-3-amine is sourced from PubChem (CID 142883636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).