About ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine
ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine (PubChem CID 142883646) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine.
Molecular Properties
| Compound Name | ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine |
| PubChem CID | 142883646 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine |
| SMILES | C=C(C)O/C(=C\C)CN.CC.CCC(C)C |
| InChI | InChI=1S/C7H13NO.C5H12.C2H6/c1-4-7(5-8)9-6(2)3;1-4-5(2)3;1-2/h4H,2,5,8H2,1,3H3;5H,4H2,1-3H3;1-2H3/b7-4-;; |
| InChIKey | RLIYMKZQAOPLKD-XIFWRFGDSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine?
The IUPAC name of ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine (CID 142883646) is ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine.
What is the SMILES notation for ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine?
The canonical SMILES for ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine is C=C(C)O/C(=C\C)CN.CC.CCC(C)C.
What is the InChIKey of ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine?
The InChIKey is RLIYMKZQAOPLKD-XIFWRFGDSA-N. The full InChI is InChI=1S/C7H13NO.C5H12.C2H6/c1-4-7(5-8)9-6(2)3;1-4-5(2)3;1-2/h4H,2,5,8H2,1,3H3;5H,4H2,1-3H3;1-2H3/b7-4-;;.
What are the key properties of ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine?
ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine has a molecular weight of 229.41 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;(Z)-2-prop-1-en-2-yloxybut-2-en-1-amine is sourced from PubChem (CID 142883646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).