C14H20N2O3 — CID 142883667
1-[(2E,4E)-4-amino-2-ethenylhexa-2,4-dienoyl]piperidine-2-carboxylic acid (PubChem CID 142883667) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(2E,4E)-4-amino-2-ethenylhexa-2,4-dienoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2E,4E)-4-amino-2-ethenylhexa-2,4-dienoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142883667 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[(2E,4E)-4-amino-2-ethenylhexa-2,4-dienoyl]piperidine-2-carboxylic acid |
| SMILES | C=C/C(=C\C(N)=C/C)C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C14H20N2O3/c1-3-10(9-11(15)4-2)13(17)16-8-6-5-7-12(16)14(18)19/h3-4,9,12H,1,5-8,15H2,2H3,(H,18,19)/b10-9+,11-4+ |
| InChIKey | CVDISMGQZSWLPN-LFXAUOBFSA-N |
| XLogP | 1.43 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|