About ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol
ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol (PubChem CID 142883915) has the molecular formula C18H38O
and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol.
Molecular Properties
| Compound Name | ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol |
| PubChem CID | 142883915 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol |
| SMILES | CC.CC(O)CC1C(C)CCC(C)(C(C)C)CC1C |
| InChI | InChI=1S/C16H32O.C2H6/c1-11(2)16(6)8-7-12(3)15(9-14(5)17)13(4)10-16;1-2/h11-15,17H,7-10H2,1-6H3;1-2H3 |
| InChIKey | MGRUTXCJPJEWDB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol?
The IUPAC name of ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol (CID 142883915) is ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol.
What is the SMILES notation for ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol?
The canonical SMILES for ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol is CC.CC(O)CC1C(C)CCC(C)(C(C)C)CC1C.
What is the InChIKey of ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol?
The InChIKey is MGRUTXCJPJEWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O.C2H6/c1-11(2)16(6)8-7-12(3)15(9-14(5)17)13(4)10-16;1-2/h11-15,17H,7-10H2,1-6H3;1-2H3.
What are the key properties of ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol?
ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol has a molecular weight of 270.50 g/mol, XLogP of 5.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2,4,7-trimethyl-4-propan-2-ylcycloheptyl)propan-2-ol is sourced from PubChem (CID 142883915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).