C16H19NO — CID 142884962
2-[[(2E,4E,6E)-deca-2,4,6-trienylidene]amino]phenol (PubChem CID 142884962) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[[(2E,4E,6E)-deca-2,4,6-trienylidene]amino]phenol.
| Compound Name | 2-[[(2E,4E,6E)-deca-2,4,6-trienylidene]amino]phenol |
|---|---|
| PubChem CID | 142884962 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[[(2E,4E,6E)-deca-2,4,6-trienylidene]amino]phenol |
| SMILES | CCC/C=C/C=C/C=C/C=N/c1ccccc1O |
| InChI | InChI=1S/C16H19NO/c1-2-3-4-5-6-7-8-11-14-17-15-12-9-10-13-16(15)18/h4-14,18H,2-3H2,1H3/b5-4+,7-6+,11-8+,17-14+ |
| InChIKey | BOHKBHJSAIXJPW-KXAFWTNHSA-N |
| XLogP | 4.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|