About N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane
N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane (PubChem CID 142885023) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane.
Molecular Properties
| Compound Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane |
| PubChem CID | 142885023 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane |
| SMILES | CC.N#C/C(N)=C(C#N)/N=C/N |
| InChI | InChI=1S/C5H5N5.C2H6/c6-1-4(9)5(2-7)10-3-8;1-2/h3H,9H2,(H2,8,10);1-2H3/b5-4-; |
| InChIKey | JOUMMMLDIKFCLS-MKWAYWHRSA-N |
| XLogP | 0.22 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane?
The IUPAC name of N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane (CID 142885023) is N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane.
What is the SMILES notation for N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane?
The canonical SMILES for N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane is CC.N#C/C(N)=C(C#N)/N=C/N.
What is the InChIKey of N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane?
The InChIKey is JOUMMMLDIKFCLS-MKWAYWHRSA-N. The full InChI is InChI=1S/C5H5N5.C2H6/c6-1-4(9)5(2-7)10-3-8;1-2/h3H,9H2,(H2,8,10);1-2H3/b5-4-;.
What are the key properties of N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane?
N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane has a molecular weight of 165.20 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-2-amino-1,2-dicyanoethenyl]methanimidamide;ethane is sourced from PubChem (CID 142885023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).