About ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol
ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol (PubChem CID 142885284) has the molecular formula C23H31FO
and a molecular weight of 342.50 g/mol. Its IUPAC name is ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol.
Molecular Properties
| Compound Name | ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol |
| PubChem CID | 142885284 |
| Molecular Formula | C23H31FO |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol |
| SMILES | C=C(/C(=C\C)c1ccc(O)cc1)C(C)C.CC.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H18O.C7H7F.C2H6/c1-5-14(11(4)10(2)3)12-6-8-13(15)9-7-12;1-6-2-4-7(8)5-3-6;1-2/h5-10,15H,4H2,1-3H3;2-5H,1H3;1-2H3/b14-5+;; |
| InChIKey | RCOSTMIIECBWIM-UPWXDAOZSA-N |
| XLogP | 7.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol?
The IUPAC name of ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol (CID 142885284) is ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol.
What is the SMILES notation for ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol?
The canonical SMILES for ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol is C=C(/C(=C\C)c1ccc(O)cc1)C(C)C.CC.Cc1ccc(F)cc1.
What is the InChIKey of ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol?
The InChIKey is RCOSTMIIECBWIM-UPWXDAOZSA-N. The full InChI is InChI=1S/C14H18O.C7H7F.C2H6/c1-5-14(11(4)10(2)3)12-6-8-13(15)9-7-12;1-6-2-4-7(8)5-3-6;1-2/h5-10,15H,4H2,1-3H3;2-5H,1H3;1-2H3/b14-5+;;.
What are the key properties of ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol?
ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol has a molecular weight of 342.50 g/mol, XLogP of 7.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-4-methylbenzene;4-[(E)-5-methyl-4-methylidenehex-2-en-3-yl]phenol is sourced from PubChem (CID 142885284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).