C24H39ClN2O3S2 — CID 142885440
3-chloroprop-1-ene;2-(3-hydroxypiperidin-1-yl)acetaldehyde;(E)-2-methyl-1-[2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl]pent-2-en-1-ol (PubChem CID 142885440) has the molecular formula C24H39ClN2O3S2 and a molecular weight of 503.17 g/mol. Its IUPAC name is 3-chloroprop-1-ene;2-(3-hydroxypiperidin-1-yl)acetaldehyde;(E)-2-methyl-1-[2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl]pent-2-en-1-ol.
| Compound Name | 3-chloroprop-1-ene;2-(3-hydroxypiperidin-1-yl)acetaldehyde;(E)-2-methyl-1-[2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 142885440 |
| Molecular Formula | C24H39ClN2O3S2 |
| Molecular Weight | 503.17 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-chloroprop-1-ene;2-(3-hydroxypiperidin-1-yl)acetaldehyde;(E)-2-methyl-1-[2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl]pent-2-en-1-ol |
| SMILES | C=CCCl.CC/C=C(\C)C(O)c1c(NC)sc2c1CCSC2.O=CCN1CCCC(O)C1 |
| InChI | InChI=1S/C14H21NOS2.C7H13NO2.C3H5Cl/c1-4-5-9(2)13(16)12-10-6-7-17-8-11(10)18-14(12)15-3;9-5-4-8-3-1-2-7(10)6-8;1-2-3-4/h5,13,15-16H,4,6-8H2,1-3H3;5,7,10H,1-4,6H2;2H,1,3H2/b9-5+;; |
| InChIKey | LAQVUKOLCKDFEX-KJDUPKRESA-N |
| XLogP | 5.02 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.17 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|