About N-benzylethanamine;diethyl 2-methylpropanedioate
N-benzylethanamine;diethyl 2-methylpropanedioate (PubChem CID 142885461) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is N-benzylethanamine;diethyl 2-methylpropanedioate.
Molecular Properties
| Compound Name | N-benzylethanamine;diethyl 2-methylpropanedioate |
| PubChem CID | 142885461 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-benzylethanamine;diethyl 2-methylpropanedioate |
| SMILES | CCNCc1ccccc1.CCOC(=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C9H13N.C8H14O4/c1-2-10-8-9-6-4-3-5-7-9;1-4-11-7(9)6(3)8(10)12-5-2/h3-7,10H,2,8H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | AKEGQMSJLXYYNT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-benzylethanamine;diethyl 2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylethanamine;diethyl 2-methylpropanedioate?
The IUPAC name of N-benzylethanamine;diethyl 2-methylpropanedioate (CID 142885461) is N-benzylethanamine;diethyl 2-methylpropanedioate.
What is the SMILES notation for N-benzylethanamine;diethyl 2-methylpropanedioate?
The canonical SMILES for N-benzylethanamine;diethyl 2-methylpropanedioate is CCNCc1ccccc1.CCOC(=O)C(C)C(=O)OCC.
What is the InChIKey of N-benzylethanamine;diethyl 2-methylpropanedioate?
The InChIKey is AKEGQMSJLXYYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C8H14O4/c1-2-10-8-9-6-4-3-5-7-9;1-4-11-7(9)6(3)8(10)12-5-2/h3-7,10H,2,8H2,1H3;6H,4-5H2,1-3H3.
What are the key properties of N-benzylethanamine;diethyl 2-methylpropanedioate?
N-benzylethanamine;diethyl 2-methylpropanedioate has a molecular weight of 309.41 g/mol, XLogP of 2.54, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylethanamine;diethyl 2-methylpropanedioate is sourced from PubChem (CID 142885461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).