C17H15FN2O3 — CID 142885777
(2S)-N-(4-cyanophenyl)-3-(4-fluorophenoxy)-2-hydroxy-2-methylpropanamide (PubChem CID 142885777) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is (2S)-N-(4-cyanophenyl)-3-(4-fluorophenoxy)-2-hydroxy-2-methylpropanamide.
| Compound Name | (2S)-N-(4-cyanophenyl)-3-(4-fluorophenoxy)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 142885777 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S)-N-(4-cyanophenyl)-3-(4-fluorophenoxy)-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@](O)(COc1ccc(F)cc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15FN2O3/c1-17(22,11-23-15-8-4-13(18)5-9-15)16(21)20-14-6-2-12(10-19)3-7-14/h2-9,22H,11H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | NCFZEEDUWMUUAF-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |