C11H21FN2O — CID 142886826
1-(5-fluoro-3,3,7-trimethyl-1,5-diazocan-1-yl)ethanone (PubChem CID 142886826) has the molecular formula C11H21FN2O and a molecular weight of 216.30 g/mol. Its IUPAC name is 1-(5-fluoro-3,3,7-trimethyl-1,5-diazocan-1-yl)ethanone.
| Compound Name | 1-(5-fluoro-3,3,7-trimethyl-1,5-diazocan-1-yl)ethanone |
|---|---|
| PubChem CID | 142886826 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(5-fluoro-3,3,7-trimethyl-1,5-diazocan-1-yl)ethanone |
| SMILES | CC(=O)N1CC(C)CN(F)CC(C)(C)C1 |
| InChI | InChI=1S/C11H21FN2O/c1-9-5-13(10(2)15)7-11(3,4)8-14(12)6-9/h9H,5-8H2,1-4H3 |
| InChIKey | MIQKOBDCDPYCPY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|