C12H24N2O — CID 142886834
1-(3,3,5,7-tetramethyl-1,5-diazocan-1-yl)ethanone (PubChem CID 142886834) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-(3,3,5,7-tetramethyl-1,5-diazocan-1-yl)ethanone.
| Compound Name | 1-(3,3,5,7-tetramethyl-1,5-diazocan-1-yl)ethanone |
|---|---|
| PubChem CID | 142886834 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-(3,3,5,7-tetramethyl-1,5-diazocan-1-yl)ethanone |
| SMILES | CC(=O)N1CC(C)CN(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-10-6-13(5)8-12(3,4)9-14(7-10)11(2)15/h10H,6-9H2,1-5H3 |
| InChIKey | QVSBKWOECHMHOS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |